cas: 1150271-33-2 — see every product listed under this CAS number, including other names
Benzyl 4-(4-bromophenyl)piperazine-1-carboxylate, 98%, 98% (CAS 1150271-33-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111FQ8-250mg |
| cas | 1150271-33-2 |
| size | 250mg |
| availability | 35g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1154.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Benzyl 4-(4-bromophenyl)piperazine-1-carboxylate (CAS 1150271-33-2) is a chemical compound with the molecular formula C18H19BrN2O2 and a molecular weight of 375.3 g/mol. IUPAC name: benzyl 4-(4-bromophenyl)piperazine-1-carboxylate. InChIKey: AOCMGNPEKPFTEC-UHFFFAOYSA-N.
| Molecular formula | C18H19BrN2O2 |
|---|---|
| Molecular weight | 375.3 g/mol |
| IUPAC name | benzyl 4-(4-bromophenyl)piperazine-1-carboxylate |
| InChIKey | AOCMGNPEKPFTEC-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1C2=CC=C(C=C2)Br)C(=O)OCC3=CC=CC=C3 |
Computed by PubChem (NCBI)