cas: 1245649-33-5 — see every product listed under this CAS number, including other names
Benzylmethyl(pyrrolidin-3-ylmethyl)carbamate, 95%, 95% (CAS 1245649-33-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch110XCB-100mg |
| cas | 1245649-33-5 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 362.00 Pln | |
| Chemat | 250mg | 563.60 Pln | |
| Chemat | 1g | 1571.60 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
Benzyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate (CAS 1245649-33-5) is a chemical compound with the molecular formula C14H20N2O2 and a molecular weight of 248.32 g/mol. IUPAC name: benzyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate. InChIKey: XPQDOUKRHNPOQO-UHFFFAOYSA-N.
| Molecular formula | C14H20N2O2 |
|---|---|
| Molecular weight | 248.32 g/mol |
| IUPAC name | benzyl N-methyl-N-(pyrrolidin-3-ylmethyl)carbamate |
| InChIKey | XPQDOUKRHNPOQO-UHFFFAOYSA-N |
| SMILES | CN(CC1CCNC1)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)