cas: 130641-38-2 — see every product listed under this CAS number, including other names
Bindarit, 99.53% (CAS 130641-38-2) is a chemical reagent available from Chemat. Available pack sizes: 10mM/1mL, 5 mg, 100 mg, 10 mg, 25 mg, 50 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-B0498-10mM/1mL |
| cas | 130641-38-2 |
| size | 10mM/1mL |
| availability | Get quote |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 10mM/1mL | 593.69 Pln | |
| MedChemExpress | 5 mg | 551.89 Pln | |
| MedChemExpress | 100 mg | 3575.14 Pln | |
| MedChemExpress | 10 mg | 816.60 Pln | |
| MedChemExpress | 25 mg | 1318.15 Pln | |
| MedChemExpress | 50 mg | 2158.72 Pln |
| delivery time | over 3 weeks |
|---|---|
| purity | 99.53% |
2-[(1-benzylindazol-3-yl)methoxy]-2-methylpropanoic acid (CAS 130641-38-2) is a chemical compound with the molecular formula C19H20N2O3 and a molecular weight of 324.4 g/mol. IUPAC name: 2-[(1-benzylindazol-3-yl)methoxy]-2-methylpropanoic acid. InChIKey: MTHORRSSURHQPZ-UHFFFAOYSA-N.
| Molecular formula | C19H20N2O3 |
|---|---|
| Molecular weight | 324.4 g/mol |
| IUPAC name | 2-[(1-benzylindazol-3-yl)methoxy]-2-methylpropanoic acid |
| InChIKey | MTHORRSSURHQPZ-UHFFFAOYSA-N |
| SMILES | CC(C)(C(=O)O)OCC1=NN(C2=CC=CC=C21)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)