cas: 109276-34-8 — see every product listed under this CAS number, including other names
Biotin LC hydrazide (CAS 109276-34-8) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GC42935-10 |
| cas | 109276-34-8 |
| size | 10mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10mg | 625.12 Pln | |
| GLPBio | 100mg | 1256.99 Pln | |
| GLPBio | 25mg | 793.62 Pln | |
| GLPBio | 5mg | 540.87 Pln | |
| GLPBio | 50mg | 1004.24 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(6-hydrazinyl-6-oxohexyl)pentanamide (CAS 109276-34-8) is a chemical compound with the molecular formula C16H29N5O3S and a molecular weight of 371.5 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(6-hydrazinyl-6-oxohexyl)pentanamide. InChIKey: IJJWOSAXNHWBPR-HUBLWGQQSA-N.
| Molecular formula | C16H29N5O3S |
|---|---|
| Molecular weight | 371.5 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-(6-hydrazinyl-6-oxohexyl)pentanamide |
| InChIKey | IJJWOSAXNHWBPR-HUBLWGQQSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCCCCC(=O)NN)NC(=O)N2 |
Computed by PubChem (NCBI)