Biotin-PEG2-OH 98%
cas: 717119-80-7 — see every product listed under this CAS number, including other names
Biotin-PEG2-OH 98% (CAS 717119-80-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1160876-100mg |
| cas | 717119-80-7 |
| size | 100mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 259.12 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 987.81 Pln | |
| Ambeed | 5g | 3424.19 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1160876 |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide (CAS 717119-80-7) is a chemical compound with the molecular formula C14H25N3O4S and a molecular weight of 331.43 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide. InChIKey: MWHYGWKFNDLVJC-GVXVVHGQSA-N.
| Molecular formula | C14H25N3O4S |
|---|---|
| Molecular weight | 331.43 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-(2-hydroxyethoxy)ethyl]pentanamide |
| InChIKey | MWHYGWKFNDLVJC-GVXVVHGQSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCO)NC(=O)N2 |
Computed by PubChem (NCBI)