cas: 113072-75-6 — see every product listed under this CAS number, including other names
Biotin-PEG5-amine, 98% (CAS 113072-75-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 25mg, 100mg. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A639602-50mg |
| cas | 113072-75-6 |
| size | 50mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 50mg | 1658.44 Pln | |
| AmBeed | 25mg | 1013.95 Pln | |
| Fluorochem | 100mg | 857.01 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (CAS 113072-75-6) is a chemical compound with the molecular formula C22H42N4O7S and a molecular weight of 506.7 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide. InChIKey: BYKYZTMBWRTPIJ-ZJOUEHCJSA-N.
| Molecular formula | C22H42N4O7S |
|---|---|
| Molecular weight | 506.7 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | BYKYZTMBWRTPIJ-ZJOUEHCJSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)