cas: 2601437-70-9 — see every product listed under this CAS number, including other names
Biotin-PEG6-Hydrazide, ≥95%, ≥95% (CAS 2601437-70-9) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch131AMF-25mg |
| cas | 2601437-70-9 |
| size | 25mg |
| availability | 0.2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 376.40 Pln | |
| Chemat | 100mg | 1005.20 Pln |
| purity | ≥95% |
|---|---|
| delivery time | 3 weeks |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (CAS 2601437-70-9) is a chemical compound with the molecular formula C25H47N5O9S and a molecular weight of 593.7 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide. InChIKey: BKVIFOCCBJHLJK-HFMPRLQTSA-N.
| Molecular formula | C25H47N5O9S |
|---|---|
| Molecular weight | 593.7 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-[2-(3-hydrazinyl-3-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | BKVIFOCCBJHLJK-HFMPRLQTSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCC(=O)NN)NC(=O)N2 |
Computed by PubChem (NCBI)