cas: 906099-89-6 — see every product listed under this CAS number, including other names
Biotin-PEG6-alcohol 98% (CAS 906099-89-6) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A755037-50mg |
| cas | 906099-89-6 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 281.38 Pln | |
| Ambeed | 100mg | 420.44 Pln | |
| Ambeed | 250mg | 937.75 Pln | |
| Ambeed | 1g | 1672.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A755037 |
5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide (CAS 906099-89-6) is a chemical compound with the molecular formula C22H41N3O8S and a molecular weight of 507.6 g/mol. IUPAC name: 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide. InChIKey: UWCUGLZFTQXZRR-ZJOUEHCJSA-N.
| Molecular formula | C22H41N3O8S |
|---|---|
| Molecular weight | 507.6 g/mol |
| IUPAC name | 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]-N-[2-[2-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethyl]pentanamide |
| InChIKey | UWCUGLZFTQXZRR-ZJOUEHCJSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCO)NC(=O)N2 |
Computed by PubChem (NCBI)