Biotin-PEG8-acid 98%
cas: 2143964-62-7 — see every product listed under this CAS number, including other names
Biotin-PEG8-acid 98% (CAS 2143964-62-7) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A754495-50mg |
| cas | 2143964-62-7 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 403.75 Pln | |
| Ambeed | 100mg | 476.06 Pln | |
| Ambeed | 250mg | 848.75 Pln | |
| Ambeed | 1g | 2161.50 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A754495 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 2143964-62-7) is a chemical compound with the molecular formula C29H53N3O12S and a molecular weight of 667.8 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: MPJWZTARMHIZLN-VBOOUTDYSA-N.
| Molecular formula | C29H53N3O12S |
|---|---|
| Molecular weight | 667.8 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | MPJWZTARMHIZLN-VBOOUTDYSA-N |
| SMILES | C1[C@H]2[C@@H]([C@@H](S1)CCCCC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O)NC(=O)N2 |
Computed by PubChem (NCBI)