cas: 604786-74-5 — see every product listed under this CAS number, including other names
Biotin-nPEG-amine (CAS 604786-74-5) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140ZS-25mg |
| cas | 604786-74-5 |
| size | 25mg |
| availability | 0.3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 678.80 Pln | |
| Chemat | 100mg | 1696.40 Pln |
| delivery time | 3 weeks |
|---|
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide (CAS 604786-74-5) is a chemical compound with the molecular formula C16H30N4O4S and a molecular weight of 374.5 g/mol. IUPAC name: N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide. InChIKey: LWISPDYGRSGXME-UHFFFAOYSA-N.
| Molecular formula | C16H30N4O4S |
|---|---|
| Molecular weight | 374.5 g/mol |
| IUPAC name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-5-(2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl)pentanamide |
| InChIKey | LWISPDYGRSGXME-UHFFFAOYSA-N |
| SMILES | C1C2C(C(S1)CCCCC(=O)NCCOCCOCCN)NC(=O)N2 |
Computed by PubChem (NCBI)