CAS 61573-60-2 appears in our catalog under these names: Bis(1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylato-κN3,κO4)copper, 98%, 98%, Bis(1,2,3,6-tetrahydro-2,6-dioxo-4-pyrimidinecarboxylato-κN3,κO4)copper, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 100mg, 250mg, 1g.
Copper bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) (CAS 61573-60-2) is a chemical compound with the molecular formula C10H6CuN4O8 and a molecular weight of 373.72 g/mol. IUPAC name: copper bis(2,4-dioxo-1H-pyrimidine-6-carboxylate). InChIKey: WKQFGWKSVRJAMI-UHFFFAOYSA-L.
| Molecular formula | C10H6CuN4O8 |
|---|---|
| Molecular weight | 373.72 g/mol |
| IUPAC name | copper bis(2,4-dioxo-1H-pyrimidine-6-carboxylate) |
| InChIKey | WKQFGWKSVRJAMI-UHFFFAOYSA-L |
| SMILES | C1=C(NC(=O)NC1=O)C(=O)[O-].C1=C(NC(=O)NC1=O)C(=O)[O-].[Cu+2] |
Computed by PubChem (NCBI)