cas: 15781-70-1 — see every product listed under this CAS number, including other names
Bis(2,4,6-trichlorophenyl) malonate 98% (CAS 15781-70-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A274698-100mg |
| cas | 15781-70-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 10g | 186.81 Pln | |
| Ambeed | 25g | 248.00 Pln | |
| Ambeed | 100g | 620.69 Pln | |
| Ambeed | 500g | 2584.25 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A274698 |
Bis(2,4,6-trichlorophenyl) propanedioate (CAS 15781-70-1) is a chemical compound with the molecular formula C15H6Cl6O4 and a molecular weight of 462.9 g/mol. IUPAC name: bis(2,4,6-trichlorophenyl) propanedioate. InChIKey: WYPCGKBOSFOHGU-UHFFFAOYSA-N.
| Molecular formula | C15H6Cl6O4 |
|---|---|
| Molecular weight | 462.9 g/mol |
| IUPAC name | bis(2,4,6-trichlorophenyl) propanedioate |
| InChIKey | WYPCGKBOSFOHGU-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OC(=O)CC(=O)OC2=C(C=C(C=C2Cl)Cl)Cl)Cl)Cl |
Computed by PubChem (NCBI)