cas: 1008402-79-6 — see every product listed under this CAS number, including other names
Bis(2,5-Dioxopyrrolidin-1-yl) 4,7,10,13,16,19,22,25,28-Nonaoxahentriacontane-1,31-Dioate, 97%, 97% (CAS 1008402-79-6) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1113ZK-25mg |
| cas | 1008402-79-6 |
| size | 25mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 131.60 Pln | |
| Chemat | 100mg | 174.80 Pln | |
| Chemat | 250mg | 294.80 Pln | |
| Chemat | 1g | 818.00 Pln | |
| Chemat | 5g | 3088.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1008402-79-6) is a chemical compound with the molecular formula C30H48N2O17 and a molecular weight of 708.7 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: CQWLSZJYTZVHMU-UHFFFAOYSA-N.
| Molecular formula | C30H48N2O17 |
|---|---|
| Molecular weight | 708.7 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | CQWLSZJYTZVHMU-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)