cas: 1314378-11-4 — see every product listed under this CAS number, including other names
Bis(2,5-dioxopyrrolidin-1-yl) 4,7,10,13-tetraoxahexadecane-1,16-dioate, 98%, 98% (CAS 1314378-11-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch111W7H-100mg |
| cas | 1314378-11-4 |
| size | 100mg |
| availability | 7.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 141.20 Pln | |
| Chemat | 250mg | 179.60 Pln | |
| Chemat | 1g | 424.40 Pln | |
| Chemat | 5g | 1302.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1314378-11-4) is a chemical compound with the molecular formula C20H28N2O12 and a molecular weight of 488.4 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: BQLKLYYHZOLCLV-UHFFFAOYSA-N.
| Molecular formula | C20H28N2O12 |
|---|---|
| Molecular weight | 488.4 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | BQLKLYYHZOLCLV-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)