cas: 23582-02-7 — see every product listed under this CAS number, including other names
Bis(2-(diphenylphosphino)ethyl)phenylphosphine, 97% (CAS 23582-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F801822-100MG |
| cas | 23582-02-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 164.54 Pln | |
| Fluorochem | 250mg | 268.67 Pln | |
| Fluorochem | 1g | 575.86 Pln | |
| Fluorochem | 5g | 1768.15 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
Bis(2-diphenylphosphanylethyl)-phenylphosphane (CAS 23582-02-7) is a chemical compound with the molecular formula C34H33P3 and a molecular weight of 534.5 g/mol. IUPAC name: bis(2-diphenylphosphanylethyl)-phenylphosphane. InChIKey: AXVOAMVQOCBPQT-UHFFFAOYSA-N.
| Molecular formula | C34H33P3 |
|---|---|
| Molecular weight | 534.5 g/mol |
| IUPAC name | bis(2-diphenylphosphanylethyl)-phenylphosphane |
| InChIKey | AXVOAMVQOCBPQT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)P(CCP(C2=CC=CC=C2)C3=CC=CC=C3)CCP(C4=CC=CC=C4)C5=CC=CC=C5 |
Computed by PubChem (NCBI)