CAS 15929-43-8 appears in our catalog under these names: Bis(4-(trifluoromethyl)phenyl)phosphine oxide, 95%, Bis(4-(trifluoromethyl)phenyl)phosphine oxide, 97%, 97%, Bis(4-(trifluoromethyl)phenyl)phosphine oxide, 97%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg, 5g.
Oxo-bis[4-(trifluoromethyl)phenyl]phosphanium (CAS 15929-43-8) is a chemical compound with the molecular formula C14H8F6OP+ and a molecular weight of 337.18 g/mol. IUPAC name: oxo-bis[4-(trifluoromethyl)phenyl]phosphanium. InChIKey: OUILBJIDCJXKEC-UHFFFAOYSA-N.
| Molecular formula | C14H8F6OP+ |
|---|---|
| Molecular weight | 337.18 g/mol |
| IUPAC name | oxo-bis[4-(trifluoromethyl)phenyl]phosphanium |
| InChIKey | OUILBJIDCJXKEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(F)(F)F)[P+](=O)C2=CC=C(C=C2)C(F)(F)F |
Computed by PubChem (NCBI)