Products 142936-49-0

CAS 142936-49-0 is the registry number for Bis(4-ethylcyclohexyl) hydrogen phosphate, 95%. Offered by: Ambeed. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Bis(4-ethylcyclohexyl) hydrogen phosphate (CAS 142936-49-0) is a chemical compound with the molecular formula C16H31O4P and a molecular weight of 318.39 g/mol. IUPAC name: bis(4-ethylcyclohexyl) hydrogen phosphate. InChIKey: BVKILVUDEKZITM-UHFFFAOYSA-N.

Identity
Molecular formulaC16H31O4P
Molecular weight318.39 g/mol
IUPAC namebis(4-ethylcyclohexyl) hydrogen phosphate
InChIKeyBVKILVUDEKZITM-UHFFFAOYSA-N
SMILESCCC1CCC(CC1)OP(=O)(O)OC2CCC(CC2)CC

Computed by PubChem (NCBI)