Bis(4-methoxycarbonylphenyl) Terephthalate, 98+%
cas: 99328-23-1 — see every product listed under this CAS number, including other names
Bis(4-methoxycarbonylphenyl) Terephthalate, 98+% (CAS 99328-23-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A857115-1g |
| cas | 99328-23-1 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 164.56 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 976.69 Pln | |
| BLDpharm | 1g | 125.54 Pln | |
| BLDpharm | 5g | 169.96 Pln | |
| BLDpharm | 25g | 347.68 Pln | |
| BLDpharm | 100g | 1047.43 Pln | |
| Chemat | 1g | 88.40 Pln | |
| Chemat | 25g | 390.80 Pln | |
| Chemat | 100g | 1173.20 Pln |
properties
| purity | 98+% |
|---|---|
| delivery time | 1-2 weeks |
Bis(4-methoxycarbonylphenyl) benzene-1,4-dicarboxylate (CAS 99328-23-1) is a chemical compound with the molecular formula C24H18O8 and a molecular weight of 434.4 g/mol. IUPAC name: bis(4-methoxycarbonylphenyl) benzene-1,4-dicarboxylate. InChIKey: XLVVPIVANBPSAY-UHFFFAOYSA-N.
| Molecular formula | C24H18O8 |
|---|---|
| Molecular weight | 434.4 g/mol |
| IUPAC name | bis(4-methoxycarbonylphenyl) benzene-1,4-dicarboxylate |
| InChIKey | XLVVPIVANBPSAY-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)C(=O)OC3=CC=C(C=C3)C(=O)OC |
Computed by PubChem (NCBI)
Synonyms:
Bis(4-methoxycarbonylphenyl) Terephthalate, Terephthalic Acid Bis[4-(methoxycarbonyl)phenyl] Ester, bis(4-methoxycarbonylphenyl) benzene-1,4-dicarboxylate, Bis(4-(methoxycarbonyl)phenyl) terephthalate, 1,4-Benzenedicarboxylic acid, bis[4-(methoxycarbonyl)phenyl] ester, Bis(4-methoxycarbonylphenyl)Terephthalate, Terephthalic acid bis-(4-methoxycarbonyl-phenyl) ester, bis[4-(methoxycarbonyl)phenyl] benzene-1,4-dicarboxylate, Bis[4-(methoxycarbonyl)phenyl] Terephthalate, 1,4-Benz
