cas: 19231-06-2 — see every product listed under this CAS number, including other names
Bis(4-methoxyphenyl)iodonium bromide 95% (CAS 19231-06-2) is a chemical reagent available from Chemat. Available pack sizes: 500g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A118765-500g |
| cas | 19231-06-2 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 13853.88 Pln | |
| Ambeed | 250mg | 136.75 Pln | |
| Ambeed | 1g | 192.38 Pln | |
| Ambeed | 5g | 375.94 Pln | |
| Ambeed | 10g | 537.25 Pln | |
| Ambeed | 25g | 1110.19 Pln | |
| Ambeed | 100g | 3518.75 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A118765 |
Bis(4-methoxyphenyl)iodanium bromide (CAS 19231-06-2) is a chemical compound with the molecular formula C14H14BrIO2 and a molecular weight of 421.07 g/mol. IUPAC name: bis(4-methoxyphenyl)iodanium bromide. InChIKey: YDSNSDXMWRVLLI-UHFFFAOYSA-M.
| Molecular formula | C14H14BrIO2 |
|---|---|
| Molecular weight | 421.07 g/mol |
| IUPAC name | bis(4-methoxyphenyl)iodanium bromide |
| InChIKey | YDSNSDXMWRVLLI-UHFFFAOYSA-M |
| SMILES | COC1=CC=C(C=C1)[I+]C2=CC=C(C=C2)OC.[Br-] |
Computed by PubChem (NCBI)