Bis(dibenzo[b,d]furan-3-yl)amine, 98%
cas: 1705595-86-3 — see every product listed under this CAS number, including other names
Bis(dibenzo[b,d]furan-3-yl)amine, 98% (CAS 1705595-86-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem, Ambeed, BLDpharm, Chemat.
| brand | Fluorochem |
|---|---|
| catalog number | F865202-100MG |
| cas | 1705595-86-3 |
| size | 100mg |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 174.96 Pln | |
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 664.37 Pln | |
| Ambeed | 250mg | 231.31 Pln | |
| Ambeed | 1g | 492.75 Pln | |
| Ambeed | 5g | 1338.25 Pln | |
| BLDpharm | 250mg | 242.16 Pln | |
| BLDpharm | 1g | 525.40 Pln | |
| BLDpharm | 5g | 1441.74 Pln | |
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 189.20 Pln | |
| Chemat | 1g | 453.20 Pln | |
| Chemat | 5g | 1240.40 Pln |
properties
| purity | 98% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 3-4 weeks |
| category | Odczynniki chemiczne |
N-dibenzofuran-3-yldibenzofuran-3-amine (CAS 1705595-86-3) is a chemical compound with the molecular formula C24H15NO2 and a molecular weight of 349.4 g/mol. IUPAC name: N-dibenzofuran-3-yldibenzofuran-3-amine. InChIKey: GFDVDLXJIBOBTA-UHFFFAOYSA-N.
| Molecular formula | C24H15NO2 |
|---|---|
| Molecular weight | 349.4 g/mol |
| IUPAC name | N-dibenzofuran-3-yldibenzofuran-3-amine |
| InChIKey | GFDVDLXJIBOBTA-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)NC4=CC5=C(C=C4)C6=CC=CC=C6O5 |
Computed by PubChem (NCBI)