CAS 12130-65-3 is the registry number for Bis(i-propylcyclopentadienyl)titanium dichloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
CAS 12130-65-3 identifies a chemical compound with the molecular formula C16H22Cl2Ti and a molecular weight of 333.1 g/mol. InChIKey: HMTIYOSDNUJYPV-UHFFFAOYSA-L.
| Molecular formula | C16H22Cl2Ti |
|---|---|
| Molecular weight | 333.1 g/mol |
| InChIKey | HMTIYOSDNUJYPV-UHFFFAOYSA-L |
| SMILES | CC(C)[C]1[CH][CH][CH][CH]1.CC(C)[C]1[CH][CH][CH][CH]1.Cl[Ti]Cl |
Computed by PubChem (NCBI)