cas: 13965-03-2 — see every product listed under this CAS number, including other names
Bis(triphenylphosphine)palladium(II) chloride, 98%, 98% (CAS 13965-03-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 25g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112BFX-100mg |
| cas | 13965-03-2 |
| size | 100mg |
| availability | 100g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 150.80 Pln | |
| Chemat | 25g | 2061.20 Pln | |
| Chemat | 50g | 4058.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Dichloropalladium;bis(triphenylphosphane) (CAS 13965-03-2) is a chemical compound with the molecular formula C36H30Cl2P2Pd and a molecular weight of 701.9 g/mol. IUPAC name: dichloropalladium;bis(triphenylphosphane). InChIKey: YNHIGQDRGKUECZ-UHFFFAOYSA-L.
| Molecular formula | C36H30Cl2P2Pd |
|---|---|
| Molecular weight | 701.9 g/mol |
| IUPAC name | dichloropalladium;bis(triphenylphosphane) |
| InChIKey | YNHIGQDRGKUECZ-UHFFFAOYSA-L |
| SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.Cl[Pd]Cl |
Computed by PubChem (NCBI)