cas: 78782-17-9 — see every product listed under this CAS number, including other names
Bis[(pinacolato)boryl]methane 95% (CAS 78782-17-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A218916-1g |
| cas | 78782-17-9 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 181.25 Pln | |
| Ambeed | 10g | 270.25 Pln | |
| Ambeed | 25g | 531.69 Pln | |
| Ambeed | 100g | 1816.62 Pln | |
| Ambeed | 500g | 8452.69 Pln | |
| Ambeed | 1000g | 14315.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A218916 |
4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane (CAS 78782-17-9) is a chemical compound with the molecular formula C13H26B2O4 and a molecular weight of 268.0 g/mol. IUPAC name: 4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane. InChIKey: MQYZGGWWHUGYDR-UHFFFAOYSA-N.
| Molecular formula | C13H26B2O4 |
|---|---|
| Molecular weight | 268.0 g/mol |
| IUPAC name | 4,4,5,5-tetramethyl-2-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]-1,3,2-dioxaborolane |
| InChIKey | MQYZGGWWHUGYDR-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CB2OC(C(O2)(C)C)(C)C |
Computed by PubChem (NCBI)