cas: 1426164-52-4 — see every product listed under this CAS number, including other names
Bis-Mal-Lysine-PEG4-acid, 98%, 98% (CAS 1426164-52-4) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch120E28-25mg |
| cas | 1426164-52-4 |
| size | 25mg |
| availability | 1.25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 640.40 Pln | |
| Chemat | 50mg | 890.00 Pln | |
| Chemat | 100mg | 1384.40 Pln | |
| Chemat | 250mg | 2915.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1426164-52-4) is a chemical compound with the molecular formula C31H45N5O13 and a molecular weight of 695.7 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: RZAXBVRZUKAYCY-UHFFFAOYSA-N.
| Molecular formula | C31H45N5O13 |
|---|---|
| Molecular weight | 695.7 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2,6-bis[3-(2,5-dioxopyrrol-1-yl)propanoylamino]hexanoylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | RZAXBVRZUKAYCY-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)NCCCCC(C(=O)NCCOCCOCCOCCOCCC(=O)O)NC(=O)CCN2C(=O)C=CC2=O |
Computed by PubChem (NCBI)