Bis-PEG6-NHS ester, 98.0%
cas: 1526718-98-8 — see every product listed under this CAS number, including other names
Bis-PEG6-NHS ester, 98.0% (CAS 1526718-98-8) is a chemical reagent available from Chemat. Available pack sizes: 1 g, 50 mg, 5 g, 100 mg, 250 mg. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-130410-1 g |
| cas | 1526718-98-8 |
| size | 1 g |
| availability | In stock |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 1 g | 937.34 Pln | |
| MedChemExpress | 50 mg | 240.74 Pln | |
| MedChemExpress | 5 g | 2664.91 Pln | |
| MedChemExpress | 100 mg | 310.40 Pln | |
| MedChemExpress | 250 mg | 431.15 Pln |
properties
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.0% |
(2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate (CAS 1526718-98-8) is a chemical compound with the molecular formula C24H36N2O14 and a molecular weight of 576.5 g/mol. IUPAC name: (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate. InChIKey: FDLGRFGWAMAWTE-UHFFFAOYSA-N.
| Molecular formula | C24H36N2O14 |
|---|---|
| Molecular weight | 576.5 g/mol |
| IUPAC name | (2,5-dioxopyrrolidin-1-yl) 3-[2-[2-[2-[2-[2-[3-(2,5-dioxopyrrolidin-1-yl)oxy-3-oxopropoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoate |
| InChIKey | FDLGRFGWAMAWTE-UHFFFAOYSA-N |
| SMILES | C1CC(=O)N(C1=O)OC(=O)CCOCCOCCOCCOCCOCCOCCC(=O)ON2C(=O)CCC2=O |
Computed by PubChem (NCBI)