cas: 119189-70-7 — see every product listed under this CAS number, including other names
Bis-PEG6-acid, 95% (CAS 119189-70-7) is a chemical reagent available from Chemat. Available pack sizes: 5g, 250mg, 1g, 100mg. Offered by: Combi-blocks, Fluorochem.
| brand | Combi-blocks |
|---|---|
| catalog number | QD-8781-5g |
| cas | 119189-70-7 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Combi-blocks | 5g | price on request | |
| Combi-blocks | 250mg | price on request | |
| Combi-blocks | 1g | price on request | |
| Fluorochem | 100mg | 190.58 Pln | |
| Fluorochem | 250mg | 299.91 Pln | |
| Fluorochem | 1g | 721.64 Pln | |
| Fluorochem | 5g | 2137.81 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks (only if in stock, to check click on availability) |
3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 119189-70-7) is a chemical compound with the molecular formula C16H30O10 and a molecular weight of 382.40 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: YFBGEYNLLRKUTP-UHFFFAOYSA-N.
| Molecular formula | C16H30O10 |
|---|---|
| Molecular weight | 382.40 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(2-carboxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | YFBGEYNLLRKUTP-UHFFFAOYSA-N |
| SMILES | C(COCCOCCOCCOCCOCCOCCC(=O)O)C(=O)O |
Computed by PubChem (NCBI)