Bixin, 98%
cas: 6983-79-5 — see every product listed under this CAS number, including other names
Bixin, 98% (CAS 6983-79-5) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A282548-1mg |
| cas | 6983-79-5 |
| size | 1mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1mg | 476.06 Pln | |
| Ambeed | 5mg | 998.94 Pln | |
| Ambeed | 10mg | 1466.19 Pln | |
| Ambeed | 25mg | 2728.88 Pln | |
| Ambeed | 50mg | 4052.75 Pln | |
| Ambeed | 100mg | 6049.69 Pln | |
| Chemat | 1mg | 482.00 Pln | |
| Chemat | 5mg | 1029.20 Pln | |
| Chemat | 10mg | 1514.00 Pln | |
| Chemat | 25mg | 2814.80 Pln | |
| Chemat | 50mg | 4192.40 Pln | |
| Chemat | 100mg | 6256.40 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
Bixin is a carotenoic acid that is the 6'-monomethyl ester of 9'-cis-6,6'-diapocarotene-6,6'-dioic acid. It has a role as an antioxidant, a biological pigment, an insulin-sensitizing drug, an anti-inflammatory agent, an apoptosis inducer and a food colouring. It is a methyl ester, a carotenoic acid and a dicarboxylic acid monoester.
Source: ChEBI
| Molecular formula | C25H30O4 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (2E,4E,6E,8E,10E,12E,14E,16Z,18E)-20-methoxy-4,8,13,17-tetramethyl-20-oxoicosa-2,4,6,8,10,12,14,16,18-nonaenoic acid |
| InChIKey | RAFGELQLHMBRHD-SLEZCNMESA-N |
| SMILES | C/C(=C\C=C\C=C(/C)\C=C\C=C(\C)/C=C/C(=O)OC)/C=C/C=C(\C)/C=C/C(=O)O |
Computed by PubChem (NCBI)