cas: 346694-77-7 — see every product listed under this CAS number, including other names
Boc-β-HoLys(Cbz)-OH 98% (CAS 346694-77-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A814816-100mg |
| cas | 346694-77-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 142.31 Pln | |
| Ambeed | 1g | 359.25 Pln | |
| Ambeed | 5g | 1221.44 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A814816 |
(3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-(phenylmethoxycarbonylamino)heptanoic acid (CAS 346694-77-7) is a chemical compound with the molecular formula C20H30N2O6 and a molecular weight of 394.5 g/mol. IUPAC name: (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-(phenylmethoxycarbonylamino)heptanoic acid. InChIKey: MAHOLRAVFZCBFL-INIZCTEOSA-N.
| Molecular formula | C20H30N2O6 |
|---|---|
| Molecular weight | 394.5 g/mol |
| IUPAC name | (3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]-7-(phenylmethoxycarbonylamino)heptanoic acid |
| InChIKey | MAHOLRAVFZCBFL-INIZCTEOSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1=CC=CC=C1)CC(=O)O |
Computed by PubChem (NCBI)