CAS 161370-66-7 appears in our catalog under these names: (S)–tert–Butyl 2–((tert–butoxycarbonyl)amino)–4–iodobutanoate, (S)-N-Boc-γ-Iodo-Abu-OtBu, 97%, 97%, (S)-tert-Butyl 2-((tert-butoxycarbonyl)amino)-4-iodobutanoate, 97%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
Tert-butyl (2S)-4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (CAS 161370-66-7) is a chemical compound with the molecular formula C13H24INO4 and a molecular weight of 385.24 g/mol. IUPAC name: tert-butyl (2S)-4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate. InChIKey: CUDXGFWLHSXMOR-VIFPVBQESA-N.
| Molecular formula | C13H24INO4 |
|---|---|
| Molecular weight | 385.24 g/mol |
| IUPAC name | tert-butyl (2S)-4-iodo-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| InChIKey | CUDXGFWLHSXMOR-VIFPVBQESA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCI)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)