cas: 560088-79-1 — see every product listed under this CAS number, including other names
Boc-AEEA-OH.DCHA 98% (CAS 560088-79-1) is a chemical reagent available from Chemat. Available pack sizes: 500g, 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A452554-500g |
| cas | 560088-79-1 |
| size | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 500g | 22342.25 Pln | |
| Ambeed | 100mg | 131.19 Pln | |
| Ambeed | 250mg | 186.81 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 487.19 Pln | |
| Ambeed | 25g | 1560.75 Pln | |
| Ambeed | 100g | 5020.62 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A452554 |
N-cyclohexylcyclohexanamine;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid (CAS 560088-79-1) is a chemical compound with the molecular formula C23H44N2O6 and a molecular weight of 444.6 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid. InChIKey: SWUXEYKTUQROOO-UHFFFAOYSA-N.
| Molecular formula | C23H44N2O6 |
|---|---|
| Molecular weight | 444.6 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]acetic acid |
| InChIKey | SWUXEYKTUQROOO-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCC(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)