cas: 1363380-83-9 — see every product listed under this CAS number, including other names
Boc-Ac4c(3,3-DiF)-OH 95% (CAS 1363380-83-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A975616-100mg |
| cas | 1363380-83-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 498.31 Pln | |
| Ambeed | 250mg | 815.38 Pln | |
| Ambeed | 1g | 1549.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A975616 |
3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1363380-83-9) is a chemical compound with the molecular formula C10H15F2NO4 and a molecular weight of 251.23 g/mol. IUPAC name: 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: KEYBLBUGXCHLBX-UHFFFAOYSA-N.
| Molecular formula | C10H15F2NO4 |
|---|---|
| Molecular weight | 251.23 g/mol |
| IUPAC name | 3,3-difluoro-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | KEYBLBUGXCHLBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1(CC(C1)(F)F)C(=O)O |
Computed by PubChem (NCBI)