cas: 90600-20-7 — see every product listed under this CAS number, including other names
Boc-Allyl-Gly-OH, 97% (CAS 90600-20-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A192756-250mg |
| cas | 90600-20-7 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 203.50 Pln | |
| Ambeed | 5g | 470.50 Pln | |
| Ambeed | 10g | 720.81 Pln | |
| Ambeed | 25g | 1694.25 Pln | |
| Ambeed | 100g | 5810.50 Pln | |
| Ambeed | 500g | 23037.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid (CAS 90600-20-7) is a chemical compound with the molecular formula C10H17NO4 and a molecular weight of 215.25 g/mol. IUPAC name: (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid. InChIKey: BUPDPLXLAKNJMI-ZETCQYMHSA-N.
| Molecular formula | C10H17NO4 |
|---|---|
| Molecular weight | 215.25 g/mol |
| IUPAC name | (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pent-4-enoic acid |
| InChIKey | BUPDPLXLAKNJMI-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC=C)C(=O)O |
Computed by PubChem (NCBI)