cas: 200124-22-7 — see every product listed under this CAS number, including other names
Boc-Arg(Pbf)-OH, 97%, 97% (CAS 200124-22-7) is a chemical reagent available from Chemat. Available pack sizes: 50g, 250mg, 1g, 5g, 10g, 25g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch113CJV-50g |
| cas | 200124-22-7 |
| size | 50g |
| availability | 140.83g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 309.20 Pln | |
| Chemat | 250mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 88.40 Pln | |
| Chemat | 10g | 112.40 Pln | |
| Chemat | 25g | 184.40 Pln | |
| Chemat | 100g | 558.80 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 200124-22-7) is a chemical compound with the molecular formula C24H38N4O7S and a molecular weight of 526.6 g/mol. IUPAC name: (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: CVFXPOKENLGCID-KRWDZBQOSA-N.
| Molecular formula | C24H38N4O7S |
|---|---|
| Molecular weight | 526.6 g/mol |
| IUPAC name | (2S)-5-[[amino-[(2,2,4,6,7-pentamethyl-3H-1-benzofuran-5-yl)sulfonylamino]methylidene]amino]-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | CVFXPOKENLGCID-KRWDZBQOSA-N |
| SMILES | CC1=C(C(=C(C2=C1OC(C2)(C)C)C)S(=O)(=O)NC(=NCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)N)C |
Computed by PubChem (NCBI)