cas: 13726-76-6 — see every product listed under this CAS number, including other names
Boc-Arg-OH, 95% (CAS 13726-76-6) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g, 500g, 1kg. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A189778-1g |
| cas | 13726-76-6 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 125.62 Pln | |
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 181.25 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 754.19 Pln | |
| Ambeed | 500g | 2461.88 Pln | |
| Ambeed | 1kg | 4842.62 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid (CAS 13726-76-6) is a chemical compound with the molecular formula C11H22N4O4 and a molecular weight of 274.32 g/mol. IUPAC name: (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid. InChIKey: HSQIYOPBCOPMSS-ZETCQYMHSA-N.
| Molecular formula | C11H22N4O4 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | (2S)-5-(diaminomethylideneamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid |
| InChIKey | HSQIYOPBCOPMSS-ZETCQYMHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCN=C(N)N)C(=O)O |
Computed by PubChem (NCBI)