cas: 101854-42-6 — see every product listed under this CAS number, including other names
Boc-D-Dab(Z)-OH.DCHA, 98+% (CAS 101854-42-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A155790-250mg |
| cas | 101854-42-6 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 421.54 Pln | |
| AmBeed | 25g | 6163.36 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
N-cyclohexylcyclohexanamine;(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)butanoic acid (CAS 101854-42-6) is a chemical compound with the molecular formula C29H47N3O6 and a molecular weight of 533.7 g/mol. IUPAC name: N-cyclohexylcyclohexanamine;(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)butanoic acid. InChIKey: CBSVEVKFQHTZSP-BTQNPOSSSA-N.
| Molecular formula | C29H47N3O6 |
|---|---|
| Molecular weight | 533.7 g/mol |
| IUPAC name | N-cyclohexylcyclohexanamine;(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-4-(phenylmethoxycarbonylamino)butanoic acid |
| InChIKey | CBSVEVKFQHTZSP-BTQNPOSSSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCNC(=O)OCC1=CC=CC=C1)C(=O)O.C1CCC(CC1)NC2CCCCC2 |
Computed by PubChem (NCBI)