cas: 210750-95-1 — see every product listed under this CAS number, including other names
Boc-D-Gln(Trt)-OH, 96% (CAS 210750-95-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 15g, 25g. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A375402-250mg |
| cas | 210750-95-1 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 314.75 Pln | |
| Ambeed | 1g | 387.06 Pln | |
| Ambeed | 5g | 1327.12 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 194.00 Pln | |
| Chemat | 5g | 602.00 Pln | |
| Chemat | 10g | 1115.60 Pln | |
| Chemat | 15g | 1595.60 Pln | |
| Chemat | 25g | 2531.60 Pln |
| purity | 96% |
|---|---|
| delivery time | 2-3 weeks |
(2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(tritylamino)pentanoic acid (CAS 210750-95-1) is a chemical compound with the molecular formula C29H32N2O5 and a molecular weight of 488.6 g/mol. IUPAC name: (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(tritylamino)pentanoic acid. InChIKey: YEXNCDUSVVLUFM-XMMPIXPASA-N.
| Molecular formula | C29H32N2O5 |
|---|---|
| Molecular weight | 488.6 g/mol |
| IUPAC name | (2R)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-oxo-5-(tritylamino)pentanoic acid |
| InChIKey | YEXNCDUSVVLUFM-XMMPIXPASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCC(=O)NC(C1=CC=CC=C1)(C2=CC=CC=C2)C3=CC=CC=C3)C(=O)O |
Computed by PubChem (NCBI)