cas: 91177-57-0 — see every product listed under this CAS number, including other names
Boc-D-Met-ol, 98% (CAS 91177-57-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed, BLDpharm, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A277797-250mg |
| cas | 91177-57-0 |
| size | 250mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 153.44 Pln | |
| Ambeed | 1g | 175.69 Pln | |
| Ambeed | 5g | 448.25 Pln | |
| BLDpharm | 250mg | 125.54 Pln | |
| BLDpharm | 1g | 186.63 Pln | |
| BLDpharm | 5g | 480.97 Pln | |
| Fluorochem | 1g | 388.42 Pln | |
| Fluorochem | 5g | 1148.57 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]carbamate (CAS 91177-57-0) is a chemical compound with the molecular formula C10H21NO3S and a molecular weight of 235.35 g/mol. IUPAC name: tert-butyl N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]carbamate. InChIKey: IPIBDQMAIDPJBU-MRVPVSSYSA-N.
| Molecular formula | C10H21NO3S |
|---|---|
| Molecular weight | 235.35 g/mol |
| IUPAC name | tert-butyl N-[(2R)-1-hydroxy-4-methylsulfanylbutan-2-yl]carbamate |
| InChIKey | IPIBDQMAIDPJBU-MRVPVSSYSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CCSC)CO |
Computed by PubChem (NCBI)