cas: 1018332-24-5 — see every product listed under this CAS number, including other names
Boc-D-Pro(4-NHFmoc)-OH (2R,4R) (CAS 1018332-24-5) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 5g. Offered by: Iris Biotech.
| brand | Iris Biotech |
|---|---|
| catalog number | BAA3690.0050 |
| cas | 1018332-24-5 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Iris Biotech | 50mg | 431.02 Pln | |
| Iris Biotech | 100mg | 591.54 Pln | |
| Iris Biotech | 250mg | 912.56 Pln | |
| Iris Biotech | 500mg | 1564.64 Pln | |
| Iris Biotech | 1g | 2367.20 Pln | |
| Iris Biotech | 5g | 8135.60 Pln |
| purity | No data |
|---|---|
| delivery time | 2 weeks |
(2R,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 1018332-24-5) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2R,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: UPXRTVAIJMUAQR-QVKFZJNVSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2R,4R)-4-(9H-fluoren-9-ylmethoxycarbonylamino)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | UPXRTVAIJMUAQR-QVKFZJNVSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H](C[C@@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)