CAS 250611-08-6 appears in our catalog under these names: Boc-L-dab-otBu hydrochloride, 98%, (S)-tert-Butyl 4-amino-2-((tert-butoxycarbonyl)amino)butanoate hydrochloride, 95%, 95%, BOC-DAB-OTBU HCL, 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 5g, 250mg, 10g.
Tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride (CAS 250611-08-6) is a chemical compound with the molecular formula C13H27ClN2O4 and a molecular weight of 310.82 g/mol. IUPAC name: tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride. InChIKey: PIFRQYRFCQGLRI-FVGYRXGTSA-N.
| Molecular formula | C13H27ClN2O4 |
|---|---|
| Molecular weight | 310.82 g/mol |
| IUPAC name | tert-butyl (2S)-4-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate;hydrochloride |
| InChIKey | PIFRQYRFCQGLRI-FVGYRXGTSA-N |
| SMILES | CC(C)(C)OC(=O)[C@H](CCN)NC(=O)OC(C)(C)C.Cl |
Computed by PubChem (NCBI)