cas: 35899-43-5 — see every product listed under this CAS number, including other names
Boc-His(Tos)-OH, 98% (CAS 35899-43-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Ambeed, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A259776-5g |
| cas | 35899-43-5 |
| size | 5g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 131.19 Pln | |
| Ambeed | 10g | 192.38 Pln | |
| Ambeed | 25g | 353.69 Pln | |
| Ambeed | 100g | 1199.19 Pln | |
| Fluorochem | 10g | 232.23 Pln | |
| Fluorochem | 25g | 299.91 Pln | |
| Fluorochem | 100g | 945.52 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(2S)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 35899-43-5) is a chemical compound with the molecular formula C18H23N3O6S and a molecular weight of 409.5 g/mol. IUPAC name: (2S)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DCLJSEPKYJSEHW-HNNXBMFYSA-N.
| Molecular formula | C18H23N3O6S |
|---|---|
| Molecular weight | 409.5 g/mol |
| IUPAC name | (2S)-3-[1-(4-methylphenyl)sulfonylimidazol-4-yl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DCLJSEPKYJSEHW-HNNXBMFYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N2C=C(N=C2)C[C@@H](C(=O)O)NC(=O)OC(C)(C)C |
Computed by PubChem (NCBI)