cas: 133628-28-1 — see every product listed under this CAS number, including other names
Boc-Lys(Fmoc)-OMe, 97% (CAS 133628-28-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100mg, 250mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A669181-1g |
| cas | 133628-28-1 |
| size | 1g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 159.00 Pln | |
| Ambeed | 5g | 431.56 Pln | |
| Ambeed | 25g | 1633.06 Pln | |
| Chemat | 100mg | 93.20 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 126.80 Pln | |
| Chemat | 5g | 328.40 Pln | |
| Chemat | 25g | 1187.60 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate (CAS 133628-28-1) is a chemical compound with the molecular formula C27H34N2O6 and a molecular weight of 482.6 g/mol. IUPAC name: methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate. InChIKey: NUSZDVABASFMMF-QHCPKHFHSA-N.
| Molecular formula | C27H34N2O6 |
|---|---|
| Molecular weight | 482.6 g/mol |
| IUPAC name | methyl (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]hexanoate |
| InChIKey | NUSZDVABASFMMF-QHCPKHFHSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCCNC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13)C(=O)OC |
Computed by PubChem (NCBI)