cas: 198227-38-2 — see every product listed under this CAS number, including other names
Boc-NH-PEG-amine (MW 2000) 97% average Mw2000 (CAS 198227-38-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1483514-100mg |
| cas | 198227-38-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 325.88 Pln | |
| Ambeed | 250mg | 448.25 Pln | |
| Ambeed | 1g | 993.38 Pln | |
| Ambeed | 5g | 3324.06 Pln |
| purity | 97% average Mw2000 |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1483514 |
Tert-butyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate (CAS 198227-38-2) is a chemical compound with the molecular formula C29H60N2O13 and a molecular weight of 644.8 g/mol. IUPAC name: tert-butyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate. InChIKey: GISRSYIQHFGCMC-UHFFFAOYSA-N.
| Molecular formula | C29H60N2O13 |
|---|---|
| Molecular weight | 644.8 g/mol |
| IUPAC name | tert-butyl N-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]carbamate |
| InChIKey | GISRSYIQHFGCMC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCN |
Computed by PubChem (NCBI)