cas: 1415981-79-1 — see every product listed under this CAS number, including other names
Boc-NH-PEG12-CH2CH2COOH 95% (CAS 1415981-79-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A633699-50mg |
| cas | 1415981-79-1 |
| size | 50mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 381.50 Pln | |
| Ambeed | 100mg | 570.62 Pln | |
| Ambeed | 250mg | 921.06 Pln | |
| Ambeed | 1g | 2923.56 Pln | |
| Ambeed | 5g | 11055.94 Pln | |
| Ambeed | 10g | 17653.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A633699 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1415981-79-1) is a chemical compound with the molecular formula C32H63NO16 and a molecular weight of 717.8 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: QMJVJXMTYZIZKH-UHFFFAOYSA-N.
| Molecular formula | C32H63NO16 |
|---|---|
| Molecular weight | 717.8 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | QMJVJXMTYZIZKH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)