cas: 756525-91-4 — see every product listed under this CAS number, including other names
Boc-NH-PEG4-CH2CH2COOH 97% (CAS 756525-91-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A108006-100mg |
| cas | 756525-91-4 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 120.06 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 264.69 Pln | |
| Ambeed | 5g | 898.81 Pln | |
| Ambeed | 25g | 2806.75 Pln | |
| Ambeed | 100g | 6483.56 Pln | |
| Ambeed | 500g | 25735.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A108006 |
3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 756525-91-4) is a chemical compound with the molecular formula C16H31NO8 and a molecular weight of 365.42 g/mol. IUPAC name: 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: YEIYIPDFZMLJQH-UHFFFAOYSA-N.
| Molecular formula | C16H31NO8 |
|---|---|
| Molecular weight | 365.42 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | YEIYIPDFZMLJQH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)