cas: 1334169-93-5 — see every product listed under this CAS number, including other names
Boc-NH-PEG8-CH2CH2COOH 95% (CAS 1334169-93-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1163457-100mg |
| cas | 1334169-93-5 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 164.56 Pln | |
| Ambeed | 250mg | 248.00 Pln | |
| Ambeed | 1g | 776.44 Pln | |
| Ambeed | 5g | 1510.69 Pln | |
| Ambeed | 25g | 6733.88 Pln | |
| Ambeed | 100g | 21391.06 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A1163457 |
3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1334169-93-5) is a chemical compound with the molecular formula C24H47NO12 and a molecular weight of 541.6 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: XYVCCDSFTREKQJ-UHFFFAOYSA-N.
| Molecular formula | C24H47NO12 |
|---|---|
| Molecular weight | 541.6 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-[2-[2-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | XYVCCDSFTREKQJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)