cas: 944283-07-2 — see every product listed under this CAS number, including other names
Boc-Ser(Fmoc-Ala)-OH 98% (CAS 944283-07-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1157326-100mg |
| cas | 944283-07-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 375.94 Pln | |
| Ambeed | 250mg | 437.12 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1157326 |
(2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 944283-07-2) is a chemical compound with the molecular formula C26H30N2O8 and a molecular weight of 498.5 g/mol. IUPAC name: (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: JNJCOUIAJPRCEQ-BTYIYWSLSA-N.
| Molecular formula | C26H30N2O8 |
|---|---|
| Molecular weight | 498.5 g/mol |
| IUPAC name | (2S)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | JNJCOUIAJPRCEQ-BTYIYWSLSA-N |
| SMILES | C[C@@H](C(=O)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)