cas: 944283-10-7 — see every product listed under this CAS number, including other names
Boc-Ser(Ile-Fmoc)-OH, ≥97%, ≥97% (CAS 944283-10-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11VQXQ-1g |
| cas | 944283-10-7 |
| size | 1g |
| availability | 5g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 352.40 Pln | |
| Chemat | 5g | 1250.00 Pln |
| purity | ≥97% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 944283-10-7) is a chemical compound with the molecular formula C29H36N2O8 and a molecular weight of 540.6 g/mol. IUPAC name: (2S)-3-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: VCCALOWXHFURQQ-DPSWKAHMSA-N.
| Molecular formula | C29H36N2O8 |
|---|---|
| Molecular weight | 540.6 g/mol |
| IUPAC name | (2S)-3-[(2S,3S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | VCCALOWXHFURQQ-DPSWKAHMSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)OC[C@@H](C(=O)O)NC(=O)OC(C)(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)