cas: 944283-26-5 — see every product listed under this CAS number, including other names
Boc-Thr(Fmoc-Leu)-OH 97% (CAS 944283-26-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1157393-100mg |
| cas | 944283-26-5 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 209.06 Pln | |
| Ambeed | 250mg | 303.62 Pln | |
| Ambeed | 1g | 620.69 Pln | |
| Ambeed | 5g | 1927.88 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1157393 |
(2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid (CAS 944283-26-5) is a chemical compound with the molecular formula C30H38N2O8 and a molecular weight of 554.6 g/mol. IUPAC name: (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid. InChIKey: RRBJZTPVMBBJNT-YWWLGCSWSA-N.
| Molecular formula | C30H38N2O8 |
|---|---|
| Molecular weight | 554.6 g/mol |
| IUPAC name | (2S,3R)-3-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-4-methylpentanoyl]oxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]butanoic acid |
| InChIKey | RRBJZTPVMBBJNT-YWWLGCSWSA-N |
| SMILES | C[C@H]([C@@H](C(=O)O)NC(=O)OC(C)(C)C)OC(=O)[C@H](CC(C)C)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)