cas: 40298-71-3 — see every product listed under this CAS number, including other names
Boc-Tyr(2,6-DI-CL-Bzl)-OH, 95%, 95% (CAS 40298-71-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11BYAS-100mg |
| cas | 40298-71-3 |
| size | 100mg |
| availability | 125g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 112.40 Pln | |
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 208.40 Pln | |
| Chemat | 5g | 645.20 Pln | |
| Chemat | 25g | 2402.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 40298-71-3) is a chemical compound with the molecular formula C21H23Cl2NO5 and a molecular weight of 440.3 g/mol. IUPAC name: (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: DODHIGHXRDNRPP-SFHVURJKSA-N.
| Molecular formula | C21H23Cl2NO5 |
|---|---|
| Molecular weight | 440.3 g/mol |
| IUPAC name | (2S)-3-[4-[(2,6-dichlorophenyl)methoxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | DODHIGHXRDNRPP-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OCC2=C(C=CC=C2Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)