Boc-Tyr(2-Br-Z)-OH, 98%
cas: 47689-67-8 — see every product listed under this CAS number, including other names
Boc-Tyr(2-Br-Z)-OH, 98% (CAS 47689-67-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 100g. Offered by: Chemat, Fluorochem.
| brand | Chemat |
|---|---|
| catalog number | Ch114OHL-1g |
| cas | 47689-67-8 |
| size | 1g |
| availability | 1500g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 83.60 Pln | |
| Chemat | 5g | 146.00 Pln | |
| Chemat | 10g | 208.40 Pln | |
| Chemat | 25g | 381.20 Pln | |
| Chemat | 100g | 1178.00 Pln | |
| Fluorochem | 1g | 117.68 Pln | |
| Fluorochem | 5g | 242.64 Pln | |
| Fluorochem | 10g | 362.39 Pln | |
| Fluorochem | 25g | 695.61 Pln | |
| Fluorochem | 100g | 2179.46 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 47689-67-8) is a chemical compound with the molecular formula C22H24BrNO7 and a molecular weight of 494.3 g/mol. IUPAC name: (2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: UYWMYJQSTUVRHR-SFHVURJKSA-N.
| Molecular formula | C22H24BrNO7 |
|---|---|
| Molecular weight | 494.3 g/mol |
| IUPAC name | (2S)-3-[4-[(2-bromophenyl)methoxycarbonyloxy]phenyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | UYWMYJQSTUVRHR-SFHVURJKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CC1=CC=C(C=C1)OC(=O)OCC2=CC=CC=C2Br)C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Boc-Tyr(2-Br-Z)-OH, Boc-L-Tyr(2-Br-Z)-OH, Boc-Tyr(2-bromo-Z)-OH, C22H24BrNO7, BOC-TYR(BR-Z)-OH, N-tert-Butoxycarbonyl-L-tyrosine 2-bromobenzylcarbonate (ester), boc-tyr(2-brz)-oh, UYWMYJQSTUVRHR-SFHVURJKSA-N, Boc-Tyr(2-Br-Z)-OH, >=99.0% (sum of enantiomers, TLC), O-{[(2-Bromophenyl)methoxy]carbonyl}-N-(tert-butoxycarbonyl)-L-tyrosine